C18H16ClN3O3S — CID 1210919
ethyl 5-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoate (PubChem CID 1210919) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is ethyl 5-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoate.
| Compound Name | ethyl 5-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 1210919 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | ethyl 5-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CSc2nc3ccccc3[nH]2)ccc1Cl |
| InChI | InChI=1S/C18H16ClN3O3S/c1-2-25-17(24)12-9-11(7-8-13(12)19)20-16(23)10-26-18-21-14-5-3-4-6-15(14)22-18/h3-9H,2,10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | AHRCMLFWYVOEMT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |