C16H20N4O4 — CID 121091966
3-methoxy-N-[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl]-1-methylpyrazole-4-carboxamide (PubChem CID 121091966) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-methoxy-N-[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-methoxy-N-[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121091966 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-methoxy-N-[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl]-1-methylpyrazole-4-carboxamide |
| SMILES | COc1cccc(CNC(=O)CNC(=O)c2cn(C)nc2OC)c1 |
| InChI | InChI=1S/C16H20N4O4/c1-20-10-13(16(19-20)24-3)15(22)18-9-14(21)17-8-11-5-4-6-12(7-11)23-2/h4-7,10H,8-9H2,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | AZONELGIBZFTIN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |