C18H22N4O5 — CID 121092151
ethyl 4-[[2-[(3-methoxy-1-methylpyrazole-4-carbonyl)-methylamino]acetyl]amino]benzoate (PubChem CID 121092151) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 4-[[2-[(3-methoxy-1-methylpyrazole-4-carbonyl)-methylamino]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(3-methoxy-1-methylpyrazole-4-carbonyl)-methylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 121092151 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl 4-[[2-[(3-methoxy-1-methylpyrazole-4-carbonyl)-methylamino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(C)C(=O)c2cn(C)nc2OC)cc1 |
| InChI | InChI=1S/C18H22N4O5/c1-5-27-18(25)12-6-8-13(9-7-12)19-15(23)11-21(2)17(24)14-10-22(3)20-16(14)26-4/h6-10H,5,11H2,1-4H3,(H,19,23) |
| InChIKey | JSISSHKYUAPEFU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |