C19H14N4O4S — CID 121097155
2-[2-oxo-2-[3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 121097155) has the molecular formula C19H14N4O4S and a molecular weight of 394.41 g/mol. Its IUPAC name is 2-[2-oxo-2-[3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-oxo-2-[3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 121097155 |
| Molecular Formula | C19H14N4O4S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[2-oxo-2-[3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)N1CC(c2nc(-c3ccsc3)no2)C1 |
| InChI | InChI=1S/C19H14N4O4S/c24-15(9-23-18(25)13-3-1-2-4-14(13)19(23)26)22-7-12(8-22)17-20-16(21-27-17)11-5-6-28-10-11/h1-6,10,12H,7-9H2 |
| InChIKey | CJRJHSRJBMHXOJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|