About 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide
2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide (PubChem CID 1211015) has the molecular formula C9H8Cl3FN2OS
and a molecular weight of 317.60 g/mol. Its IUPAC name is 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide |
| PubChem CID | 1211015 |
| Molecular Formula | C9H8Cl3FN2OS |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide |
| SMILES | O=C(CF)N[C@H](Sc1ccccn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H8Cl3FN2OS/c10-9(11,12)8(15-6(16)5-13)17-7-3-1-2-4-14-7/h1-4,8H,5H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | RLEXQAGPGPILRT-MRVPVSSYSA-N |
| XLogP | 2.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide?
The IUPAC name of 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide (CID 1211015) is 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide.
What is the SMILES notation for 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide?
The canonical SMILES for 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide is O=C(CF)N[C@H](Sc1ccccn1)C(Cl)(Cl)Cl.
What is the InChIKey of 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide?
The InChIKey is RLEXQAGPGPILRT-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H8Cl3FN2OS/c10-9(11,12)8(15-6(16)5-13)17-7-3-1-2-4-14-7/h1-4,8H,5H2,(H,15,16)/t8-/m1/s1.
What are the key properties of 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide?
2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide has a molecular weight of 317.60 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(1R)-2,2,2-trichloro-1-pyridin-2-ylsulfanylethyl]acetamide is sourced from PubChem (CID 1211015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).