C23H22N6O3 — CID 121103913
1-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]-N-(2-oxochromen-3-yl)piperidine-3-carboxamide (PubChem CID 121103913) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]-N-(2-oxochromen-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]-N-(2-oxochromen-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121103913 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]-N-(2-oxochromen-3-yl)piperidine-3-carboxamide |
| SMILES | Cc1nccn1-c1ccc(N2CCCC(C(=O)Nc3cc4ccccc4oc3=O)C2)nn1 |
| InChI | InChI=1S/C23H22N6O3/c1-15-24-10-12-29(15)21-9-8-20(26-27-21)28-11-4-6-17(14-28)22(30)25-18-13-16-5-2-3-7-19(16)32-23(18)31/h2-3,5,7-10,12-13,17H,4,6,11,14H2,1H3,(H,25,30) |
| InChIKey | CLTGYTYKDUOVTQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|