C15H17N3O2 — CID 121105751
[3-(hydroxymethyl)azetidin-1-yl]-[4-(imidazol-1-ylmethyl)phenyl]methanone (PubChem CID 121105751) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is [3-(hydroxymethyl)azetidin-1-yl]-[4-(imidazol-1-ylmethyl)phenyl]methanone.
| Compound Name | [3-(hydroxymethyl)azetidin-1-yl]-[4-(imidazol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 121105751 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | [3-(hydroxymethyl)azetidin-1-yl]-[4-(imidazol-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(Cn2ccnc2)cc1)N1CC(CO)C1 |
| InChI | InChI=1S/C15H17N3O2/c19-10-13-8-18(9-13)15(20)14-3-1-12(2-4-14)7-17-6-5-16-11-17/h1-6,11,13,19H,7-10H2 |
| InChIKey | PODNHDHPMSZQFS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |