C24H27N3O3 — CID 121106619
N-[2-[4-(4-ethoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]-4-phenylbutanamide (PubChem CID 121106619) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[2-[4-(4-ethoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]-4-phenylbutanamide.
| Compound Name | N-[2-[4-(4-ethoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 121106619 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[2-[4-(4-ethoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]-4-phenylbutanamide |
| SMILES | CCOc1ccc(-c2cc(=O)n(CCNC(=O)CCCc3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-30-21-13-11-20(12-14-21)22-17-24(29)27(18-26-22)16-15-25-23(28)10-6-9-19-7-4-3-5-8-19/h3-5,7-8,11-14,17-18H,2,6,9-10,15-16H2,1H3,(H,25,28) |
| InChIKey | VWYULVFSUXAFQA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |