C27H32N4O2 — CID 121107033
(4-tert-butylphenyl)-[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 121107033) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (4-tert-butylphenyl)-[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121107033 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (4-tert-butylphenyl)-[4-[6-(4-ethoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | CCOc1ccc(-c2cc(N3CCN(C(=O)c4ccc(C(C)(C)C)cc4)CC3)ncn2)cc1 |
| InChI | InChI=1S/C27H32N4O2/c1-5-33-23-12-8-20(9-13-23)24-18-25(29-19-28-24)30-14-16-31(17-15-30)26(32)21-6-10-22(11-7-21)27(2,3)4/h6-13,18-19H,5,14-17H2,1-4H3 |
| InChIKey | YZJJDWBSAGDAIJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |