About N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide
N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 121109699) has the molecular formula C15H24F3N3O3
and a molecular weight of 351.37 g/mol. Its IUPAC name is N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide.
Molecular Properties
| Compound Name | N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide |
| PubChem CID | 121109699 |
| Molecular Formula | C15H24F3N3O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | O=C(NCC1CCN(C2CCOCC2)CC1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H24F3N3O3/c16-15(17,18)10-20-14(23)13(22)19-9-11-1-5-21(6-2-11)12-3-7-24-8-4-12/h11-12H,1-10H2,(H,19,22)(H,20,23) |
| InChIKey | LNIGIEWNGXHFSE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide?
The IUPAC name of N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide (CID 121109699) is N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide.
What is the SMILES notation for N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide?
The canonical SMILES for N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide is O=C(NCC1CCN(C2CCOCC2)CC1)C(=O)NCC(F)(F)F.
What is the InChIKey of N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide?
The InChIKey is LNIGIEWNGXHFSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F3N3O3/c16-15(17,18)10-20-14(23)13(22)19-9-11-1-5-21(6-2-11)12-3-7-24-8-4-12/h11-12H,1-10H2,(H,19,22)(H,20,23).
What are the key properties of N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide?
N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide has a molecular weight of 351.37 g/mol, XLogP of 0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-N'-(2,2,2-trifluoroethyl)oxamide is sourced from PubChem (CID 121109699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).