C22H27NO4 — CID 121112229
(E)-3-(3,4-dimethoxyphenyl)-N-(5-hydroxy-3-phenylpentyl)prop-2-enamide (PubChem CID 121112229) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(5-hydroxy-3-phenylpentyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(5-hydroxy-3-phenylpentyl)prop-2-enamide |
|---|---|
| PubChem CID | 121112229 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(5-hydroxy-3-phenylpentyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCC(CCO)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H27NO4/c1-26-20-10-8-17(16-21(20)27-2)9-11-22(25)23-14-12-19(13-15-24)18-6-4-3-5-7-18/h3-11,16,19,24H,12-15H2,1-2H3,(H,23,25)/b11-9+ |
| InChIKey | QCROILJTNZJAEB-PKNBQFBNSA-N |
| XLogP | 3.39 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|