C22H23N7O3 — CID 121114458
N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-6-(2-methylimidazol-1-yl)pyridazine-3-carboxamide (PubChem CID 121114458) has the molecular formula C22H23N7O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-6-(2-methylimidazol-1-yl)pyridazine-3-carboxamide.
| Compound Name | N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-6-(2-methylimidazol-1-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 121114458 |
| Molecular Formula | C22H23N7O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-6-(2-methylimidazol-1-yl)pyridazine-3-carboxamide |
| SMILES | Cc1nccn1-c1ccc(C(=O)NCCNC(=O)c2ccc(NC(=O)C3CC3)cc2)nn1 |
| InChI | InChI=1S/C22H23N7O3/c1-14-23-12-13-29(14)19-9-8-18(27-28-19)22(32)25-11-10-24-20(30)15-4-6-17(7-5-15)26-21(31)16-2-3-16/h4-9,12-13,16H,2-3,10-11H2,1H3,(H,24,30)(H,25,32)(H,26,31) |
| InChIKey | DEWOZEMGAZTNDP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|