C16H29N5O4 — CID 121115335
4-[4-ethyl-1-(2-methoxyethyl)-5-oxo-1,2,4-triazol-3-yl]-N-(2-methoxyethyl)piperidine-1-carboxamide (PubChem CID 121115335) has the molecular formula C16H29N5O4 and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-[4-ethyl-1-(2-methoxyethyl)-5-oxo-1,2,4-triazol-3-yl]-N-(2-methoxyethyl)piperidine-1-carboxamide.
| Compound Name | 4-[4-ethyl-1-(2-methoxyethyl)-5-oxo-1,2,4-triazol-3-yl]-N-(2-methoxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 121115335 |
| Molecular Formula | C16H29N5O4 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 4-[4-ethyl-1-(2-methoxyethyl)-5-oxo-1,2,4-triazol-3-yl]-N-(2-methoxyethyl)piperidine-1-carboxamide |
| SMILES | CCn1c(C2CCN(C(=O)NCCOC)CC2)nn(CCOC)c1=O |
| InChI | InChI=1S/C16H29N5O4/c1-4-20-14(18-21(16(20)23)10-12-25-3)13-5-8-19(9-6-13)15(22)17-7-11-24-2/h13H,4-12H2,1-3H3,(H,17,22) |
| InChIKey | DERHNNUFGGHPKY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|