C16H18N6O4 — CID 121116075
2-(2,5-dioxopyrrolidin-1-yl)-N-[2-(4-methyl-5-oxo-3-pyridin-2-yl-1,2,4-triazol-1-yl)ethyl]acetamide (PubChem CID 121116075) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N-[2-(4-methyl-5-oxo-3-pyridin-2-yl-1,2,4-triazol-1-yl)ethyl]acetamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[2-(4-methyl-5-oxo-3-pyridin-2-yl-1,2,4-triazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 121116075 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[2-(4-methyl-5-oxo-3-pyridin-2-yl-1,2,4-triazol-1-yl)ethyl]acetamide |
| SMILES | Cn1c(-c2ccccn2)nn(CCNC(=O)CN2C(=O)CCC2=O)c1=O |
| InChI | InChI=1S/C16H18N6O4/c1-20-15(11-4-2-3-7-17-11)19-22(16(20)26)9-8-18-12(23)10-21-13(24)5-6-14(21)25/h2-4,7H,5-6,8-10H2,1H3,(H,18,23) |
| InChIKey | XGCLSKIZTIJLGC-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|