C16H15N3O2 — CID 121117153
2-benzyl-4-cyclopropyl-5-(furan-2-yl)-1,2,4-triazol-3-one (PubChem CID 121117153) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-benzyl-4-cyclopropyl-5-(furan-2-yl)-1,2,4-triazol-3-one.
| Compound Name | 2-benzyl-4-cyclopropyl-5-(furan-2-yl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121117153 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-benzyl-4-cyclopropyl-5-(furan-2-yl)-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2ccccc2)nc(-c2ccco2)n1C1CC1 |
| InChI | InChI=1S/C16H15N3O2/c20-16-18(11-12-5-2-1-3-6-12)17-15(14-7-4-10-21-14)19(16)13-8-9-13/h1-7,10,13H,8-9,11H2 |
| InChIKey | KZKINGUITDQBMY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |