C14H14F2N4O2 — CID 121119455
1-(2,5-difluorophenyl)-3-[2-(4-methyl-6-oxopyrimidin-1-yl)ethyl]urea (PubChem CID 121119455) has the molecular formula C14H14F2N4O2 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[2-(4-methyl-6-oxopyrimidin-1-yl)ethyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[2-(4-methyl-6-oxopyrimidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 121119455 |
| Molecular Formula | C14H14F2N4O2 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[2-(4-methyl-6-oxopyrimidin-1-yl)ethyl]urea |
| SMILES | Cc1cc(=O)n(CCNC(=O)Nc2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C14H14F2N4O2/c1-9-6-13(21)20(8-18-9)5-4-17-14(22)19-12-7-10(15)2-3-11(12)16/h2-3,6-8H,4-5H2,1H3,(H2,17,19,22) |
| InChIKey | ZCXQWMUTBSTHMF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |