About 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide
6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 121120867) has the molecular formula C18H15Br2N3O4
and a molecular weight of 497.14 g/mol. Its IUPAC name is 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide.
Molecular Properties
| Compound Name | 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide |
| PubChem CID | 121120867 |
| Molecular Formula | C18H15Br2N3O4 |
| Molecular Weight | 497.14 g/mol |
| Exact Mass | 494.94 |
| IUPAC Name | 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1ncn(CCNC(=O)c2cc3cc(Br)cc(Br)c3oc2=O)c(=O)c1C |
| InChI | InChI=1S/C18H15Br2N3O4/c1-9-10(2)22-8-23(17(9)25)4-3-21-16(24)13-6-11-5-12(19)7-14(20)15(11)27-18(13)26/h5-8H,3-4H2,1-2H3,(H,21,24) |
| InChIKey | LSLYWEVSOZEBJN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide?
The IUPAC name of 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide (CID 121120867) is 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide.
What is the SMILES notation for 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide?
The canonical SMILES for 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide is Cc1ncn(CCNC(=O)c2cc3cc(Br)cc(Br)c3oc2=O)c(=O)c1C.
What is the InChIKey of 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide?
The InChIKey is LSLYWEVSOZEBJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Br2N3O4/c1-9-10(2)22-8-23(17(9)25)4-3-21-16(24)13-6-11-5-12(19)7-14(20)15(11)27-18(13)26/h5-8H,3-4H2,1-2H3,(H,21,24).
What are the key properties of 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide?
6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide has a molecular weight of 497.14 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-N-[2-(4,5-dimethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide is sourced from PubChem (CID 121120867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).