C17H19N3O3 — CID 121121112
(E)-3-(4-methoxyphenyl)-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]prop-2-enamide (PubChem CID 121121112) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 121121112 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[2-(5-methyl-6-oxopyrimidin-1-yl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCn2cncc(C)c2=O)cc1 |
| InChI | InChI=1S/C17H19N3O3/c1-13-11-18-12-20(17(13)22)10-9-19-16(21)8-5-14-3-6-15(23-2)7-4-14/h3-8,11-12H,9-10H2,1-2H3,(H,19,21)/b8-5+ |
| InChIKey | OEADMMVUSHYMCU-VMPITWQZSA-N |
| XLogP | 1.39 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|