C22H26N2O3S2 — CID 121121906
4-butoxy-N-[[4-methyl-2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]benzenesulfonamide (PubChem CID 121121906) has the molecular formula C22H26N2O3S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is 4-butoxy-N-[[4-methyl-2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]benzenesulfonamide.
| Compound Name | 4-butoxy-N-[[4-methyl-2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121121906 |
| Molecular Formula | C22H26N2O3S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-butoxy-N-[[4-methyl-2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)NCc2sc(-c3ccccc3C)nc2C)cc1 |
| InChI | InChI=1S/C22H26N2O3S2/c1-4-5-14-27-18-10-12-19(13-11-18)29(25,26)23-15-21-17(3)24-22(28-21)20-9-7-6-8-16(20)2/h6-13,23H,4-5,14-15H2,1-3H3 |
| InChIKey | KECMZXZKSKPQEL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|