C16H13ClN4O4S2 — CID 121122452
2-chloro-N-[(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]-5-nitrobenzenesulfonamide (PubChem CID 121122452) has the molecular formula C16H13ClN4O4S2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 2-chloro-N-[(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-[(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121122452 |
| Molecular Formula | C16H13ClN4O4S2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 2-chloro-N-[(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1nc(-c2cccnc2)sc1CNS(=O)(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H13ClN4O4S2/c1-10-14(26-16(20-10)11-3-2-6-18-8-11)9-19-27(24,25)15-7-12(21(22)23)4-5-13(15)17/h2-8,19H,9H2,1H3 |
| InChIKey | WSDBDIJIWWXWAY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|