C12H13IN2O2S2 — CID 121122948
N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-4-iodobenzenesulfonamide (PubChem CID 121122948) has the molecular formula C12H13IN2O2S2 and a molecular weight of 408.29 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-4-iodobenzenesulfonamide.
| Compound Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 121122948 |
| Molecular Formula | C12H13IN2O2S2 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-4-iodobenzenesulfonamide |
| SMILES | Cc1nc(C)c(CNS(=O)(=O)c2ccc(I)cc2)s1 |
| InChI | InChI=1S/C12H13IN2O2S2/c1-8-12(18-9(2)15-8)7-14-19(16,17)11-5-3-10(13)4-6-11/h3-6,14H,7H2,1-2H3 |
| InChIKey | QWVOLOPOWPAIBY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|