C18H14ClIN2OS — CID 121123060
N-[[2-(2-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-iodobenzamide (PubChem CID 121123060) has the molecular formula C18H14ClIN2OS and a molecular weight of 468.75 g/mol. Its IUPAC name is N-[[2-(2-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-iodobenzamide.
| Compound Name | N-[[2-(2-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 121123060 |
| Molecular Formula | C18H14ClIN2OS |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | N-[[2-(2-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-iodobenzamide |
| SMILES | Cc1nc(-c2ccccc2Cl)sc1CNC(=O)c1ccccc1I |
| InChI | InChI=1S/C18H14ClIN2OS/c1-11-16(10-21-17(23)13-7-3-5-9-15(13)20)24-18(22-11)12-6-2-4-8-14(12)19/h2-9H,10H2,1H3,(H,21,23) |
| InChIKey | OWBFIOZCAGOVFN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|