C14H16N4O2S — CID 1211233
1-[(3aR,8bR)-8b-hydroxy-2-(2-propan-2-ylidenehydrazinyl)-3aH-[1,3]thiazolo[5,4-b]indol-4-yl]ethanone (PubChem CID 1211233) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-[(3aR,8bR)-8b-hydroxy-2-(2-propan-2-ylidenehydrazinyl)-3aH-[1,3]thiazolo[5,4-b]indol-4-yl]ethanone.
| Compound Name | 1-[(3aR,8bR)-8b-hydroxy-2-(2-propan-2-ylidenehydrazinyl)-3aH-[1,3]thiazolo[5,4-b]indol-4-yl]ethanone |
|---|---|
| PubChem CID | 1211233 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[(3aR,8bR)-8b-hydroxy-2-(2-propan-2-ylidenehydrazinyl)-3aH-[1,3]thiazolo[5,4-b]indol-4-yl]ethanone |
| SMILES | CC(=O)N1c2ccccc2[C@]2(O)N=C(NN=C(C)C)S[C@@H]12 |
| InChI | InChI=1S/C14H16N4O2S/c1-8(2)16-17-13-15-14(20)10-6-4-5-7-11(10)18(9(3)19)12(14)21-13/h4-7,12,20H,1-3H3,(H,15,17)/t12-,14-/m1/s1 |
| InChIKey | PPNIYFKPUGBVLH-TZMCWYRMSA-N |
| XLogP | 1.61 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|