C18H14F3N3OS — CID 121128280
1-(6-methyl-1,3-benzothiazol-2-yl)-N-(2,3,4-trifluorophenyl)azetidine-3-carboxamide (PubChem CID 121128280) has the molecular formula C18H14F3N3OS and a molecular weight of 377.39 g/mol. Its IUPAC name is 1-(6-methyl-1,3-benzothiazol-2-yl)-N-(2,3,4-trifluorophenyl)azetidine-3-carboxamide.
| Compound Name | 1-(6-methyl-1,3-benzothiazol-2-yl)-N-(2,3,4-trifluorophenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 121128280 |
| Molecular Formula | C18H14F3N3OS |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-(6-methyl-1,3-benzothiazol-2-yl)-N-(2,3,4-trifluorophenyl)azetidine-3-carboxamide |
| SMILES | Cc1ccc2nc(N3CC(C(=O)Nc4ccc(F)c(F)c4F)C3)sc2c1 |
| InChI | InChI=1S/C18H14F3N3OS/c1-9-2-4-12-14(6-9)26-18(23-12)24-7-10(8-24)17(25)22-13-5-3-11(19)15(20)16(13)21/h2-6,10H,7-8H2,1H3,(H,22,25) |
| InChIKey | VIOGWBZERJLYPH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|