About N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride
N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride (PubChem CID 12113) has the molecular formula C18H23ClN2O2
and a molecular weight of 334.85 g/mol. Its IUPAC name is N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride |
| PubChem CID | 12113 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride |
| SMILES | CCOc1ccc(/N=C(\C)Nc2ccc(OCC)cc2)cc1.Cl |
| InChI | InChI=1S/C18H22N2O2.ClH/c1-4-21-17-10-6-15(7-11-17)19-14(3)20-16-8-12-18(13-9-16)22-5-2;/h6-13H,4-5H2,1-3H3,(H,19,20);1H |
| InChIKey | RRRKUSYYBYVFMC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride?
The IUPAC name of N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride (CID 12113) is N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride.
What is the SMILES notation for N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride?
The canonical SMILES for N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride is CCOc1ccc(/N=C(\C)Nc2ccc(OCC)cc2)cc1.Cl.
What is the InChIKey of N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride?
The InChIKey is RRRKUSYYBYVFMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2.ClH/c1-4-21-17-10-6-15(7-11-17)19-14(3)20-16-8-12-18(13-9-16)22-5-2;/h6-13H,4-5H2,1-3H3,(H,19,20);1H.
What are the key properties of N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride?
N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride has a molecular weight of 334.85 g/mol, XLogP of 5.07, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(4-ethoxyphenyl)ethanimidamide;hydrochloride is sourced from PubChem (CID 12113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).