C15H17NO4 — CID 121132736
N-[3-(furan-3-yl)-3-hydroxypropyl]-3-methoxybenzamide (PubChem CID 121132736) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is N-[3-(furan-3-yl)-3-hydroxypropyl]-3-methoxybenzamide.
| Compound Name | N-[3-(furan-3-yl)-3-hydroxypropyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 121132736 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[3-(furan-3-yl)-3-hydroxypropyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCC(O)c2ccoc2)c1 |
| InChI | InChI=1S/C15H17NO4/c1-19-13-4-2-3-11(9-13)15(18)16-7-5-14(17)12-6-8-20-10-12/h2-4,6,8-10,14,17H,5,7H2,1H3,(H,16,18) |
| InChIKey | GHBUAMJMLZHPBE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |