C17H20N2O5 — CID 121133079
N-[3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-2-methyl-3-nitrobenzamide (PubChem CID 121133079) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 121133079 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1cc(C(O)CCNC(=O)c2cccc([N+](=O)[O-])c2C)c(C)o1 |
| InChI | InChI=1S/C17H20N2O5/c1-10-9-14(12(3)24-10)16(20)7-8-18-17(21)13-5-4-6-15(11(13)2)19(22)23/h4-6,9,16,20H,7-8H2,1-3H3,(H,18,21) |
| InChIKey | BWYOWSIDDJKLJD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|