C16H20N2O4S — CID 121133292
N-[3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-N'-(thiophen-3-ylmethyl)oxamide (PubChem CID 121133292) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-[3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-N'-(thiophen-3-ylmethyl)oxamide.
| Compound Name | N-[3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-N'-(thiophen-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 121133292 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-N'-(thiophen-3-ylmethyl)oxamide |
| SMILES | Cc1cc(C(O)CCNC(=O)C(=O)NCc2ccsc2)c(C)o1 |
| InChI | InChI=1S/C16H20N2O4S/c1-10-7-13(11(2)22-10)14(19)3-5-17-15(20)16(21)18-8-12-4-6-23-9-12/h4,6-7,9,14,19H,3,5,8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | YWZCQTNDMDBSQS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|