C12H17N5O2 — CID 121137212
N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 121137212) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 121137212 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CN(C)c1ccnc(CNC(=O)C2CCC(=O)N2)n1 |
| InChI | InChI=1S/C12H17N5O2/c1-17(2)10-5-6-13-9(16-10)7-14-12(19)8-3-4-11(18)15-8/h5-6,8H,3-4,7H2,1-2H3,(H,14,19)(H,15,18) |
| InChIKey | MOAKDKPJIYQFCX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |