About N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide
N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide (PubChem CID 121139309) has the molecular formula C25H27N3O
and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide |
| PubChem CID | 121139309 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCCn1nc(C2CC2)cc1C1CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O/c29-25(24(20-7-3-1-4-8-20)21-9-5-2-6-10-21)26-15-16-28-23(19-13-14-19)17-22(27-28)18-11-12-18/h1-10,17-19,24H,11-16H2,(H,26,29) |
| InChIKey | UNSITIWNJHVTAF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide?
The IUPAC name of N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide (CID 121139309) is N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide?
The canonical SMILES for N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide is O=C(NCCn1nc(C2CC2)cc1C1CC1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide?
The InChIKey is UNSITIWNJHVTAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O/c29-25(24(20-7-3-1-4-8-20)21-9-5-2-6-10-21)26-15-16-28-23(19-13-14-19)17-22(27-28)18-11-12-18/h1-10,17-19,24H,11-16H2,(H,26,29).
What are the key properties of N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide?
N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide has a molecular weight of 385.51 g/mol, XLogP of 4.59, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-diphenylacetamide is sourced from PubChem (CID 121139309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).