C19H23N3O4S — CID 121139441
methyl 4-[2-(3,5-dicyclopropylpyrazol-1-yl)ethylsulfamoyl]benzoate (PubChem CID 121139441) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 4-[2-(3,5-dicyclopropylpyrazol-1-yl)ethylsulfamoyl]benzoate.
| Compound Name | methyl 4-[2-(3,5-dicyclopropylpyrazol-1-yl)ethylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 121139441 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 4-[2-(3,5-dicyclopropylpyrazol-1-yl)ethylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCCn2nc(C3CC3)cc2C2CC2)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-26-19(23)15-6-8-16(9-7-15)27(24,25)20-10-11-22-18(14-4-5-14)12-17(21-22)13-2-3-13/h6-9,12-14,20H,2-5,10-11H2,1H3 |
| InChIKey | GBZPLIBNLOMOGA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |