About 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile
1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile (PubChem CID 1211445) has the molecular formula C11H9N4O2+
and a molecular weight of 229.22 g/mol. Its IUPAC name is 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile.
Molecular Properties
| Compound Name | 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile |
| PubChem CID | 1211445 |
| Molecular Formula | C11H9N4O2+ |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile |
| SMILES | N#Cc1ccc[n+](Cc2cc(=O)[nH]c(=O)[nH]2)c1 |
| InChI | InChI=1S/C11H8N4O2/c12-5-8-2-1-3-15(6-8)7-9-4-10(16)14-11(17)13-9/h1-4,6H,7H2,(H-,13,14,16,17)/p+1 |
| InChIKey | GJNIMKRNYJGDCK-UHFFFAOYSA-O |
| XLogP | -0.73 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile?
The IUPAC name of 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile (CID 1211445) is 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile.
What is the SMILES notation for 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile?
The canonical SMILES for 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile is N#Cc1ccc[n+](Cc2cc(=O)[nH]c(=O)[nH]2)c1.
What is the InChIKey of 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile?
The InChIKey is GJNIMKRNYJGDCK-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H8N4O2/c12-5-8-2-1-3-15(6-8)7-9-4-10(16)14-11(17)13-9/h1-4,6H,7H2,(H-,13,14,16,17)/p+1.
What are the key properties of 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile?
1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile has a molecular weight of 229.22 g/mol, XLogP of -0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]pyridin-1-ium-3-carbonitrile is sourced from PubChem (CID 1211445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).