C12H10F7N5O — CID 121144994
2,2,3,3,4,4,4-heptafluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]butanamide (PubChem CID 121144994) has the molecular formula C12H10F7N5O and a molecular weight of 373.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]butanamide |
|---|---|
| PubChem CID | 121144994 |
| Molecular Formula | C12H10F7N5O |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]butanamide |
| SMILES | O=C(NCCCc1cnc2ncnn2c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F7N5O/c13-10(14,11(15,16)12(17,18)19)8(25)20-3-1-2-7-4-21-9-22-6-23-24(9)5-7/h4-6H,1-3H2,(H,20,25) |
| InChIKey | XVYUPYGMBGVXAE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|