C11H10F5N5O — CID 121145000
2,2,3,3,3-pentafluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]propanamide (PubChem CID 121145000) has the molecular formula C11H10F5N5O and a molecular weight of 323.23 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]propanamide |
|---|---|
| PubChem CID | 121145000 |
| Molecular Formula | C11H10F5N5O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl]propanamide |
| SMILES | O=C(NCCCc1cnc2ncnn2c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F5N5O/c12-10(13,11(14,15)16)8(22)17-3-1-2-7-4-18-9-19-6-20-21(9)5-7/h4-6H,1-3H2,(H,17,22) |
| InChIKey | COJLJYZLOUXKNX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|