C19H25N3O5 — CID 121145179
3,4,5-trimethoxy-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzamide (PubChem CID 121145179) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 121145179 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3,4,5-trimethoxy-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2cnn(CC3CCCCO3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H25N3O5/c1-24-16-8-13(9-17(25-2)18(16)26-3)19(23)21-14-10-20-22(11-14)12-15-6-4-5-7-27-15/h8-11,15H,4-7,12H2,1-3H3,(H,21,23) |
| InChIKey | MBJOYSUZIJWNRH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |