C16H18N8O3 — CID 121146045
1-[2-oxo-2-[4-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 121146045) has the molecular formula C16H18N8O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-[2-oxo-2-[4-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-oxo-2-[4-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 121146045 |
| Molecular Formula | C16H18N8O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[2-oxo-2-[4-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CN1C(=O)CCC1=O)N1CCN(c2ccc(-n3cncn3)nn2)CC1 |
| InChI | InChI=1S/C16H18N8O3/c25-14-3-4-15(26)23(14)9-16(27)22-7-5-21(6-8-22)12-1-2-13(20-19-12)24-11-17-10-18-24/h1-2,10-11H,3-9H2 |
| InChIKey | OLTIXKQUVFJFAZ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 117.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|