C18H15N3OS — CID 121148230
N-[2-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide (PubChem CID 121148230) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is N-[2-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide.
| Compound Name | N-[2-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 121148230 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[2-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1cn2c(n1)SCC2)c1ccccc1 |
| InChI | InChI=1S/C18H15N3OS/c22-17(13-6-2-1-3-7-13)19-15-9-5-4-8-14(15)16-12-21-10-11-23-18(21)20-16/h1-9,12H,10-11H2,(H,19,22) |
| InChIKey | SPRPHGZGNVVLNU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |