C24H16BrN3O3 — CID 121149115
6-bromo-N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 121149115) has the molecular formula C24H16BrN3O3 and a molecular weight of 474.31 g/mol. Its IUPAC name is 6-bromo-N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | 6-bromo-N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 121149115 |
| Molecular Formula | C24H16BrN3O3 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 6-bromo-N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1cccn2cc(-c3ccccc3NC(=O)c3cc4cc(Br)ccc4oc3=O)nc12 |
| InChI | InChI=1S/C24H16BrN3O3/c1-14-5-4-10-28-13-20(26-22(14)28)17-6-2-3-7-19(17)27-23(29)18-12-15-11-16(25)8-9-21(15)31-24(18)30/h2-13H,1H3,(H,27,29) |
| InChIKey | YGIRUWYPSUDMKF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|