C19H18FN5O3S — CID 121150864
3-fluoro-N-[3-[3-(triazol-1-yl)pyrrolidine-1-carbonyl]phenyl]benzenesulfonamide (PubChem CID 121150864) has the molecular formula C19H18FN5O3S and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-fluoro-N-[3-[3-(triazol-1-yl)pyrrolidine-1-carbonyl]phenyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[3-[3-(triazol-1-yl)pyrrolidine-1-carbonyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121150864 |
| Molecular Formula | C19H18FN5O3S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-fluoro-N-[3-[3-(triazol-1-yl)pyrrolidine-1-carbonyl]phenyl]benzenesulfonamide |
| SMILES | O=C(c1cccc(NS(=O)(=O)c2cccc(F)c2)c1)N1CCC(n2ccnn2)C1 |
| InChI | InChI=1S/C19H18FN5O3S/c20-15-4-2-6-18(12-15)29(27,28)22-16-5-1-3-14(11-16)19(26)24-9-7-17(13-24)25-10-8-21-23-25/h1-6,8,10-12,17,22H,7,9,13H2 |
| InChIKey | JNPKKCOXPLQGAH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |