C11H11BrN4O2 — CID 121150950
(5-bromofuran-2-yl)-[3-(triazol-1-yl)pyrrolidin-1-yl]methanone (PubChem CID 121150950) has the molecular formula C11H11BrN4O2 and a molecular weight of 311.14 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[3-(triazol-1-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[3-(triazol-1-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 121150950 |
| Molecular Formula | C11H11BrN4O2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | (5-bromofuran-2-yl)-[3-(triazol-1-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)o1)N1CCC(n2ccnn2)C1 |
| InChI | InChI=1S/C11H11BrN4O2/c12-10-2-1-9(18-10)11(17)15-5-3-8(7-15)16-6-4-13-14-16/h1-2,4,6,8H,3,5,7H2 |
| InChIKey | VXEXCPHWJPEKTJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |