C14H13ClFN3O5S2 — CID 121155106
3-chloro-N-[2-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidin-1-yl]-2-oxoethyl]-4-fluorobenzenesulfonamide (PubChem CID 121155106) has the molecular formula C14H13ClFN3O5S2 and a molecular weight of 421.86 g/mol. Its IUPAC name is 3-chloro-N-[2-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidin-1-yl]-2-oxoethyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-[2-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidin-1-yl]-2-oxoethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 121155106 |
| Molecular Formula | C14H13ClFN3O5S2 |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 3-chloro-N-[2-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidin-1-yl]-2-oxoethyl]-4-fluorobenzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(F)c(Cl)c1)N1CC(N2C(=O)CSC2=O)C1 |
| InChI | InChI=1S/C14H13ClFN3O5S2/c15-10-3-9(1-2-11(10)16)26(23,24)17-4-12(20)18-5-8(6-18)19-13(21)7-25-14(19)22/h1-3,8,17H,4-7H2 |
| InChIKey | CFLCZDAPAZJGCV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|