C19H16FN3O5S2 — CID 121155112
N-[3-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidine-1-carbonyl]phenyl]-2-fluorobenzenesulfonamide (PubChem CID 121155112) has the molecular formula C19H16FN3O5S2 and a molecular weight of 449.49 g/mol. Its IUPAC name is N-[3-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidine-1-carbonyl]phenyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[3-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidine-1-carbonyl]phenyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 121155112 |
| Molecular Formula | C19H16FN3O5S2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | N-[3-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)azetidine-1-carbonyl]phenyl]-2-fluorobenzenesulfonamide |
| SMILES | O=C(c1cccc(NS(=O)(=O)c2ccccc2F)c1)N1CC(N2C(=O)CSC2=O)C1 |
| InChI | InChI=1S/C19H16FN3O5S2/c20-15-6-1-2-7-16(15)30(27,28)21-13-5-3-4-12(8-13)18(25)22-9-14(10-22)23-17(24)11-29-19(23)26/h1-8,14,21H,9-11H2 |
| InChIKey | ZBVWTBLCPXVPRI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|