C18H19NO4 — CID 121155598
4-[1-(2,4-dimethylbenzoyl)azetidin-3-yl]oxy-6-methylpyran-2-one (PubChem CID 121155598) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-[1-(2,4-dimethylbenzoyl)azetidin-3-yl]oxy-6-methylpyran-2-one.
| Compound Name | 4-[1-(2,4-dimethylbenzoyl)azetidin-3-yl]oxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 121155598 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-[1-(2,4-dimethylbenzoyl)azetidin-3-yl]oxy-6-methylpyran-2-one |
| SMILES | Cc1ccc(C(=O)N2CC(Oc3cc(C)oc(=O)c3)C2)c(C)c1 |
| InChI | InChI=1S/C18H19NO4/c1-11-4-5-16(12(2)6-11)18(21)19-9-15(10-19)23-14-7-13(3)22-17(20)8-14/h4-8,15H,9-10H2,1-3H3 |
| InChIKey | GNAHTEAGXKDADO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |