C14H22N2O5S — CID 121156762
3-(1-cyclohexylsulfonylpiperidin-4-yl)-1,3-oxazolidine-2,4-dione (PubChem CID 121156762) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(1-cyclohexylsulfonylpiperidin-4-yl)-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(1-cyclohexylsulfonylpiperidin-4-yl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 121156762 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(1-cyclohexylsulfonylpiperidin-4-yl)-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1COC(=O)N1C1CCN(S(=O)(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C14H22N2O5S/c17-13-10-21-14(18)16(13)11-6-8-15(9-7-11)22(19,20)12-4-2-1-3-5-12/h11-12H,1-10H2 |
| InChIKey | KTAAJFMHVMFLIB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |