About N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide
N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide (PubChem CID 121159552) has the molecular formula C20H20N4O3
and a molecular weight of 364.40 g/mol. Its IUPAC name is N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide.
Molecular Properties
| Compound Name | N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide |
| PubChem CID | 121159552 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)N1CC(N2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C20H20N4O3/c25-17-11-21-19(26)24(17)16-12-23(13-16)20(27)22-18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16,18H,11-13H2,(H,21,26)(H,22,27) |
| InChIKey | DMTCKNXGZDIHKM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide?
The IUPAC name of N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide (CID 121159552) is N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide.
What is the SMILES notation for N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide?
The canonical SMILES for N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide is O=C(NC(c1ccccc1)c1ccccc1)N1CC(N2C(=O)CNC2=O)C1.
What is the InChIKey of N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide?
The InChIKey is DMTCKNXGZDIHKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3/c25-17-11-21-19(26)24(17)16-12-23(13-16)20(27)22-18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16,18H,11-13H2,(H,21,26)(H,22,27).
What are the key properties of N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide?
N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide has a molecular weight of 364.40 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydryl-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide is sourced from PubChem (CID 121159552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).