About N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide
N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide (PubChem CID 121159557) has the molecular formula C17H24N4O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide |
| PubChem CID | 121159557 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)N1CC(N2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C17H24N4O3/c22-14-7-18-15(23)21(14)13-8-20(9-13)16(24)19-17-4-10-1-11(5-17)3-12(2-10)6-17/h10-13H,1-9H2,(H,18,23)(H,19,24) |
| InChIKey | ODXRSPXMYAUSHP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide?
The IUPAC name of N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide (CID 121159557) is N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide.
What is the SMILES notation for N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide?
The canonical SMILES for N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide is O=C(NC12CC3CC(CC(C3)C1)C2)N1CC(N2C(=O)CNC2=O)C1.
What is the InChIKey of N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide?
The InChIKey is ODXRSPXMYAUSHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O3/c22-14-7-18-15(23)21(14)13-8-20(9-13)16(24)19-17-4-10-1-11(5-17)3-12(2-10)6-17/h10-13H,1-9H2,(H,18,23)(H,19,24).
What are the key properties of N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide?
N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide has a molecular weight of 332.40 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-3-(2,5-dioxoimidazolidin-1-yl)azetidine-1-carboxamide is sourced from PubChem (CID 121159557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).