C15H15N5O3S — CID 121159966
3-[1-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121159966) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is 3-[1-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121159966 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-[1-(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C(c1cc(-c2cccs2)[nH]n1)N1CCC(N2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C15H15N5O3S/c21-13-7-16-15(23)20(13)9-3-4-19(8-9)14(22)11-6-10(17-18-11)12-2-1-5-24-12/h1-2,5-6,9H,3-4,7-8H2,(H,16,23)(H,17,18) |
| InChIKey | GBEAYBUSPXMNIS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|