C14H18N4O3S — CID 121160380
3-[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 121160380) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160380 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 3-[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1nc(C)c(C(=O)N2CCC(N3C(=O)CNC3=O)CC2)s1 |
| InChI | InChI=1S/C14H18N4O3S/c1-8-12(22-9(2)16-8)13(20)17-5-3-10(4-6-17)18-11(19)7-15-14(18)21/h10H,3-7H2,1-2H3,(H,15,21) |
| InChIKey | BLFAELKTVDJMAT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|