C18H18F3N3O2 — CID 121160983
[4-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 121160983) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is [4-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 121160983 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [4-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | Cc1cc(OC2CCN(C(=O)c3ccc(F)c(F)c3F)CC2)nc(C)n1 |
| InChI | InChI=1S/C18H18F3N3O2/c1-10-9-15(23-11(2)22-10)26-12-5-7-24(8-6-12)18(25)13-3-4-14(19)17(21)16(13)20/h3-4,9,12H,5-8H2,1-2H3 |
| InChIKey | UXNBHPPCUXVLOX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|