C22H30N4O3 — CID 121161062
N-(4-butoxyphenyl)-4-(2,6-dimethylpyrimidin-4-yl)oxypiperidine-1-carboxamide (PubChem CID 121161062) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-4-(2,6-dimethylpyrimidin-4-yl)oxypiperidine-1-carboxamide.
| Compound Name | N-(4-butoxyphenyl)-4-(2,6-dimethylpyrimidin-4-yl)oxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 121161062 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-(4-butoxyphenyl)-4-(2,6-dimethylpyrimidin-4-yl)oxypiperidine-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)N2CCC(Oc3cc(C)nc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O3/c1-4-5-14-28-19-8-6-18(7-9-19)25-22(27)26-12-10-20(11-13-26)29-21-15-16(2)23-17(3)24-21/h6-9,15,20H,4-5,10-14H2,1-3H3,(H,25,27) |
| InChIKey | DAZYPYQNOVHQEM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|